| Identification | |
| Name: | Pyrimidine,2-methoxy-4-methyl- |
| Synonyms: | 2-Methoxy-4-methylpyrimidine;2-Methoxy-6-methylpyrimidine; |
| CAS: | 14001-60-6 |
| Molecular Formula: | C6H8N2O |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C6H8N2O/c1-5-3-4-7-6(8-5)9-2/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.068 g/cm3 |
| Refractive index: | 1.496 |
| Appearance: | Colourless Liquid |
| Specification: |
The 2-Methoxy-4-methylpyrimidine with the CAS number 14001-60-6 is also called Pyrimidine,2-methoxy-4-methyl-. Its molecular formula is C6H8N2O. This chemical belongs to the following product categories: (1)Pyrimidine; (2)Nucleotides and Nucleosides; (3)Bases & Related Reagents; (4)Nucleotides. It is colourless liquid. The properties of the 2-Methoxy-4-methylpyrimidine are: (1)ACD/LogP: 0.68; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.68; (4)ACD/LogD (pH 7.4): 0.68; (5)ACD/BCF (pH 5.5): 1.93; (6)ACD/BCF (pH 7.4): 1.93; (7)ACD/KOC (pH 5.5): 55.78; (8)ACD/KOC (pH 7.4): 55.79; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 35.01 Å2; (13)Index of Refraction: 1.496; (14)Molar Refractivity: 33.93 cm3; (15)Molar Volume: 116.1 cm3; (16)Polarizability: 13.45×10-24cm3; (17)Surface Tension: 38.7 dyne/cm; (18)Enthalpy of Vaporization: 43.13 kJ/mol; (19)Vapour Pressure: 0.241 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
