| Identification |
| Name: | 1(2H)-Pyrimidinepropanoicacid, a-amino-5-fluoro-3,4-dihydro-2,4-dioxo-,(aS)- |
| Synonyms: | 1(2H)-Pyrimidinepropanoicacid, a-amino-5-fluoro-3,4-dihydro-2,4-dioxo-,(S)-; (5S)-Fluorowillardiine; (S)-5-Fluorowillardiine |
| CAS: | 140187-23-1 |
| Molecular Formula: | C7H8 F N3 O4 |
| Molecular Weight: | 217.154523 |
| InChI: | InChI=1S/C7H8FN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4H,2,9H2,(H,13,14)(H,10,12,15)/t4-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 235ºC |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.64 g/cm3 |
| Refractive index: | 1.601 |
| Water Solubility: | Soluble to 50 mM in 1 eq. NaOH. |
| Solubility: | Soluble to 50 mM in 1 eq. NaOH. |
| Appearance: | off-white Solid |
| Biological Activity: | A more potent and selective AMPA receptor agonist (at hGluR1 and hGluR2) than AMPA itself (K i = 14.7, 25.1, and 1820 nM for hGluR1, hGluR2 and hGluR5 respectively). Also available as part of the AMPA Receptor Tocriset™ . |
| Flash Point: | °C |
| Safety Data |
| |
 |
