| Identification |
| Name: | Methanol,1,1-diethoxy-, 1-acetate |
| Synonyms: | Aceticacid, anhydride with diethyl orthoformate (8CI);Methanol, diethoxy-, acetate(9CI);Orthoformic acid, diethyl ester, anhydride with acetic acid (8CI);Diethoxymethyl acetate;NSC 158267; |
| CAS: | 14036-06-7 |
| EINECS: | 237-873-4 |
| Molecular Formula: | C7H14O4 |
| Molecular Weight: | 162.18 |
| InChI: | InChI=1/C7H14O4/c1-4-9-7(10-5-2)11-6(3)8/h7H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 |
| Density: | 0.993 |
| Refractive index: | 1.399 |
| Appearance: | COLORLESS LIQUID |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
