InChI: | InChI=1/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
Specification: |
Neomycin as a DNA binder
Pilch and coworkers' study showed that the association constant for neomycin with A-site RNA was found to be in the ~109 range. However over 50 years after its discovery, its DNA binding properties were still unknown. In 2000, Arya and coworkers discovered that neomycin induces enormous thermal stabilization of triplex DNA while having little or almost no effect on the DNA duplex stabilization. They also showed that, neomycin likes anything that adopts A-form type structure, triplex DNA being one of them. Their continuous search for selective ligands for a particular type of nucleic acid gave rise to many new conjugates.
|