| Identification | |
| Name: | 1H-Imidazole-1-butanamide,N-methoxy-2-nitro- |
| Synonyms: | KIN844 |
| CAS: | 140448-34-6 |
| Molecular Formula: | C8H12 N4 O4 |
| Molecular Weight: | 228.21 |
| InChI: | InChI=1/C8H12N4O4/c1-16-10-7(13)3-2-5-11-6-4-9-8(11)12(14)15/h4,6H,2-3,5H2,1H3,(H,10,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
N-Methoxy-2-nitro-1H-imidazole-1-butanamide , its cas register number is 140448-34-6. It also can be called Kin-844 ; and 1H-Imidazole-1-butanamide, N-methoxy-2-nitro- . |
| Flash Point: | °C |
| Safety Data | |
 |
|
