| Identification | |
| Name: | Diazene,1,2-bis(3,4-dichlorophenyl)- |
| Synonyms: | Azobenzene,3,3',4,4'-tetrachloro- (6CI,7CI,8CI); Diazene, bis(3,4-dichlorophenyl)- (9CI);3,3',4,4'-Tetrachloroazobenzene; TCAB |
| CAS: | 14047-09-7 |
| Molecular Formula: | C12H6 Cl4 N2 |
| Molecular Weight: | 320.00 |
| InChI: | InChI=1/C12H6Cl4N2/c13-9-3-1-7(5-11(9)15)17-18-8-2-4-10(14)12(16)6-8/h1-6H/b18-17+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.9 ºC |
| Boiling Point: | 441.6 ºC |
| Density: | 1.48 g/cm3 |
| Refractive index: | 1.636 |
| Specification: |
3,3',4,4'-Tetrachloroazobenzene (CAS NO.14047-09-7) is a contaminant generated during the synthesis of 3,4-dichloroaniline and 3,4-dichloroaniline-derived pesticides. It is isosteric to 2,3,7,8-tetrachlorodibenzo-p-dioxin and has been shown to bind to the Ah receptor. The extensive azo reduction of 3,3',4,4'-Tetrachloroazobenzene decreases its systemic absorption after oral administration and thereby limits the amount of parent compound available to interact with the Ah receptor and decreases the Ah receptor-mediated toxicity. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 220.9 ºC |
| Safety Data | |
 |
|
