| Identification | |
| Name: | 4-Carboxyphenylboronic acid |
| Synonyms: | Benzoic acid, p-borono-;(4-formyloxyphenyl)boronic acid;p-Carboxyphenylboronic acid;Benzoic acid, 4-borono-;4-16-00-01683 (Beilstein Handbook Reference);Benzeneboronic acid, p-carboxy-;p-Boronobenzoic acid;p-Carboxybenzeneboronic acid;Benzoic acid, p-borono- (6CI,7CI,8CI);Benzoic acid, 4-borono- (9CI);4-Carboxybenzeneboronic acid; |
| CAS: | 14047-29-1 |
| Molecular Formula: | C7H7BO4 |
| Molecular Weight: | 165.94 |
| InChI: | InChI=1/C7H7BO4/c9-5-12-7-3-1-6(2-4-7)8(10)11/h1-5,10-11H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.3g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.585 |
| Solubility: | Very soluble |
| Appearance: | odorless white - off-white powder |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
