| Identification |
| Name: | 1,3,4-Thiadiazol-2-amine,5-ethyl- |
| Synonyms: | 1,3,4-Thiadiazole,2-amino-5-ethyl- (6CI,7CI,8CI);(5-Ethyl-1,3,4-thiadiazol-2-yl)amine;2-Amino-5-ethyl-1,3,4-thiadiazole;2-Ethyl-5-amino-1,3,4-thiadiazole;5-Amino-2-ethyl-1,3,4-thiadiazole;5-Ethyl-1,3,4-thiadiazol-2-amine;5-Ethyl-2-amino-1,3,4-thiadiazole;NSC 75711; |
| CAS: | 14068-53-2 |
| EINECS: | 237-921-4 |
| Molecular Formula: | C4H7N3S |
| Molecular Weight: | 129.18 |
| InChI: | InChI=1/C4H7N3S/c1-2-3-6-7-4(5)8-3/h2H2,1H3,(H2,5,7) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 115.4°C |
| Boiling Point: | 250 |
| Density: | 1.418 g/cm3 (-123 C) |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.605 |
| Appearance: | White to light beige solid. |
| Flash Point: | 115.4°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
