| Identification |
| Name: | Formamide,N,N-diethyl-1-(methylsulfinyl)- (9CI) |
| Synonyms: | Methyldiethylthiocarbamate sulfoxide; S-Methyl-N,N-diethylthiocarbamate sulfoxide;S-Methyl-N,N-diethylthiocarbamoyl sulfoxide |
| CAS: | 140703-15-7 |
| Molecular Formula: | C6H13 N O2 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H13NO2S/c1-4-7(5-2)6(8)10(3)9/h4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 108.3°C |
| Boiling Point: | 255.4°Cat760mmHg |
| Density: | 1.154g/cm3 |
| Refractive index: | 1.512 |
| Flash Point: | 108.3°C |
| Usage: | An oxygenated metabolite of Disulfiram (Antabuse) that is capable of in vitro inactivation of liver mitochondrial aldehyde dehydrogenase (EC 1.2.1.3, ALDH) |
| Safety Data |
| |
 |
