| Identification | |
| Name: | Benzo-18-crown-6 |
| Synonyms: | 18-Benzo-6-crownether; 2,3-Benzo-1,4,7,10,13,16-hexaoxacyclooctadeca-2-ene; 2,3-Benzo-18-crown-6;Benzo-18-crown-6; Benzo18C6; Monobenzo-18-crown-6 |
| CAS: | 14098-24-9 |
| EINECS: | -0 |
| Molecular Formula: | C16H24O6 |
| Molecular Weight: | 312.35816 |
| InChI: | InChI=1S/C16H24O6/c1-2-4-16-15(3-1)21-13-11-19-9-7-17-5-6-18-8-10-20-12-14-22-16/h1-4H,5-14H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | DS. |
| Density: | 1.057 g/cm3 |
| Refractive index: | 1.456 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white powder |
| Specification: |
1,4,7,10,13,16-Benzohexaoxacyclooctadecin,2,3,5,6,8,9,11,12,14,15-decahydro- , its cas register number is 928-98-3. It also can be called 2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine .1,4,7,10,13,16-Benzohexaoxacyclooctadecin,2,3,5,6,8,9,11,12,14,15-decahydro- (CAS NO.14098-24-9) is irritating to eyes, respiratory system and skin. And it is harmful by inhalation, in contact with skin and if swallowed. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
