Identification |
Name: | dibutyl succinate |
Synonyms: | Succinic Acid Dibutyl Ester; Butanedioic acid, dibutyl ester; SUCCINIC ACID DI-N-BUTYL ESTER; Tabutrex; |
CAS: | 141-03-7 |
EINECS: | 205-449-8 |
Molecular Formula: | C12H22O4 |
Molecular Weight: | 230.3 |
InChI: | InChI=1/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3082 |
Melting Point: | -29 C |
Flash Point: | 144 C |
Boiling Point: | 274 - 275 C |
Density: | 0.977g/cm3 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.4273 (20 C) |
Water Solubility: | Soluble AUTOIGNITION |
Solubility: | Soluble AUTOIGNITION |
Appearance: | Clear liquid |
Packinggroup: | Z01 |
Flash Point: | 144 C |
Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
Color: | Colorless liquid |
Usage: | Insecticide. |
Safety Data |
Hazard Symbols |
N:Dangerousfortheenvironment
|
|
 |