| Identification |
| Name: | dibutyl succinate |
| Synonyms: | Succinic Acid Dibutyl Ester; Butanedioic acid, dibutyl ester; SUCCINIC ACID DI-N-BUTYL ESTER; Tabutrex; |
| CAS: | 141-03-7 |
| EINECS: | 205-449-8 |
| Molecular Formula: | C12H22O4 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Melting Point: | -29 C |
| Flash Point: | 144 C |
| Boiling Point: | 274 - 275 C |
| Density: | 0.977g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.4273 (20 C) |
| Water Solubility: | Soluble AUTOIGNITION |
| Solubility: | Soluble AUTOIGNITION |
| Appearance: | Clear liquid |
| Packinggroup: | Z01 |
| Flash Point: | 144 C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Colorless liquid |
| Usage: | Insecticide. |
| Safety Data |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
| |
 |
