| Identification | |
| Name: | Butanoic acid,3,7-dimethyl-6-octen-1-yl ester |
| Synonyms: | Butanoicacid, 3,7-dimethyl-6-octenyl ester (9CI); Butyric acid, 3,7-dimethyl-6-octenylester (7CI,8CI); Butyric acid, ester with citronellol (6CI); 6-Octen-1-ol,3,7-dimethyl-, butyrate (8CI); 2,6-Dimethyl-2-octen-8-ol ester with butyricacid; 2,6-Dimethyl-2-octen-8-yl butyrate; 3,7-Dimethyl-6-octenyl butanoate;Citronellol butyrate; Citronellyl butanoate; Citronellyl butyrate; Citronellyln-butyrate; NSC 46147 |
| CAS: | 141-16-2 |
| EINECS: | 205-463-4 |
| Molecular Formula: | C14H26 O2 |
| Molecular Weight: | 226.40 |
| InChI: | InChI=1/C14H26O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h8,13H,5-7,9-11H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 92.8°C |
| Boiling Point: | 294.6°Cat760mmHg |
| Density: | 0.881g/cm3 |
| Refractive index: | n20/D 1.445(lit.) |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 92.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
