| Identification | |
| Name: | 7-Octen-1-ol,3,7-dimethyl- |
| Synonyms: | 3,7-Dimethyl-7-octen-1-ol |
| CAS: | 141-25-3 |
| EINECS: | 205-473-9 |
| Molecular Formula: | C10H20 O |
| Molecular Weight: | 156.30 |
| InChI: | InChI=1/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h10-11H,1,4-8H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 147.6°C |
| Boiling Point: | 400°Cat760mmHg |
| Density: | 0.915g/cm3 |
| Refractive index: | n20/D 1.469(lit.) |
| Specification: |
2,6-Dimethyl-1-octen-8-ol ,its cas register number is 141-25-3. It also can be called Rhodinol ; and 3,7-Dimethyl-7-octen-1-ol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 147.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
