| Identification | |
| Name: | 2,6-Octadienal,3,7-dimethyl-, (2E)- |
| Synonyms: | 2,6-Octadienal,3,7-dimethyl-, (E)- (8CI); (2E)-3,7-Dimethyl-2,6-octadien-1-al;(2E)-3,7-Dimethyl-2,6-octadienal; (E)-3,7-Dimethyl-2,6-octadienal;(E)-3,7-Dimethyl-2,6-octadienal; (E)-Citral; (E)-Geranial; (E)-Neral; Citral a;Geranaldehyde; Geranial; trans-3,7-Dimethyl-2,6-octadien-1-al;trans-3,7-Dimethyl-2,6-octadienal; trans-Citral; a-Citral; b-Geranial |
| CAS: | 141-27-5 |
| EINECS: | 205-476-5 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.26 |
| InChI: | InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2922 |
| Flash Point: | 101.7°C |
| Boiling Point: | 229°Cat760mmHg |
| Density: | 0.856g/cm3 |
| Refractive index: | 1.456 |
| Solubility: | Soluble in 5 volumes of 60% alcohol; soluble in all proportions of benzyl benzoate, diethyl phthalate, glycerin, propylene glycol, mineral oil, fixed oils, and 95% alcohol. Solubility in alcohol: 1 mL in 7 mL 70% alcohol In water, 1.34X10+3 mg/L at 37 deg C |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 101.7°C |
| Color: | Mobile pale yellow liquid |
| Safety Data | |
 |
|
