| Identification | |
| Name: | 3,6-Dichloropyridazine |
| Synonyms: | 3,6-Dichloro Pyridine; 3,6-Dichlorpyridazin; 1-Benzyl-2-pyrrolidinone-4-carboxylic acid |
| CAS: | 141-30-0 |
| EINECS: | 205-478-6 |
| Molecular Formula: | C4H2Cl2N2 |
| Molecular Weight: | 148.98 |
| InChI: | InChI=1/C4H2Cl2N2/c5-3-1-2-4(6)8-7-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.493 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.4346 (20 C) |
| Solubility: | Insoluble |
| Appearance: | off-white to brownish crystalline powder |
| Specification: |
?3.6-Dichloropyridazine (CAS NO.141-30-0) is also named as NSC 54498?; Pyridazine, 3,6-dichloro- . It is off-white to brownish crystalline powder. |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
