| Identification |
| Name: | 2,6-Dimethylmorpholine |
| Synonyms: | Dimethylmorpholine; 2,6-2-methyl morpholine; |
| CAS: | 141-91-3 |
| EINECS: | 205-509-3 |
| Molecular Formula: | C6H13NO |
| Molecular Weight: | 115.17 |
| InChI: | InChI=1/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1992 |
| Density: | 0.935 |
| Stability: | Stable. Incompatible with oxidizing agents, strong acids. Flammable. |
| Refractive index: | n20/D 1.446(lit.) |
| Solubility: | >=0.01 g/100 mL at 19 ºC in water |
| Appearance: | Clear liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | LIQUID |
| Usage: | Manufacture of corrosion inhibitors, stabilizer for chlorinated solvents, rubless floor polishes, rubber accelerators, germicides, textile finishing agents, prc: fungicides. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
