| Identification | |
| Name: | Disulfide,bis(2-fluorophenyl) |
| Synonyms: | Disulfide,bis(o-fluorophenyl) (8CI);Bis(2-fluorophenyl)disulfide; |
| CAS: | 14135-38-7 |
| Molecular Formula: | C12H8F2S2 |
| Molecular Weight: | 287.22792 |
| InChI: | InChI=1/C12H8F2S2/c13-9-5-1-3-7-11(9)15-16-12-8-4-2-6-10(12)14/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130.5°C |
| Boiling Point: | 292.2°Cat760mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.64 |
| Specification: |
The 2,2'-Difluorodiphenyl disulfide with the cas number 14135-38-7 is also called Disulfide,bis(2-fluorophenyl). The IUPAC name is 1-fluoro-3-[(3-fluorophenyl)disulfanyl]benzene. Its molecular formula is C12H8F2S2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 4.40; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 5; (4)ACD/LogD (pH 7.4): 5; (5)ACD/BCF (pH 5.5): 2805; (6)ACD/BCF (pH 7.4): 2805; (7)ACD/KOC (pH 5.5): 10225; (8)ACD/KOC (pH 7.4): 10225; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 50.6Å2; (13)Index of Refraction: 1.64; (14)Molar Refractivity: 67.715 cm3; (15)Molar Volume: 188.023 cm3; (16)Polarizability: 26.844×10-24cm3; (17)Surface Tension: 48.797 dyne/cm; (18)Enthalpy of Vaporization: 51.036 kJ/mol; (19)Vapour Pressure: 0.003 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 130.5°C |
| Safety Data | |
 |
|
