| Identification | |
| Name: | 1H-Imidazole,2-[(2,3-dihydro-1H-inden-1-ylidene)methyl]-1-methyl-5-nitro- |
| Synonyms: | BRN 4260975;1H-Imidazole, 2-((2,3-dihydro-1H-inden-1-ylidene)methyl)-1-methyl-5-nitro;2-((2,3-Dihydro-1H-inden-1-ylidene)methyl)-1-methyl-5-nitro-1H-imidazole;AC1O60I6;LS-78461;2-[(E)-2,3-dihydroinden-1-ylidenemethyl]-1-methyl-5-nitroimidazole;141363-21-5 |
| CAS: | 141363-21-5 |
| Molecular Formula: | C14H13 N3 O2 |
| Molecular Weight: | 255.30 |
| InChI: | InChI=1/C14H13N3O2/c1-16-13(15-9-14(16)17(18)19)8-11-7-6-10-4-2-3-5-12(10)11/h2-5,8-9H,6-7H2,1H3/b11-8+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 245.9°C |
| Boiling Point: | 482.9°C at 760 mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
1H-Imidazole,2-((2,3-dihydro-1H-inden-1-ylidene)methyl)-1-methyl-5-nitro with cas registry number of 141363-21-5 is also known as 2-((2,3-Dihydro-1H-inden-1-ylidene)methyl)-1-methyl-5-nitro-1H-imidazole . It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, dry place. 1H-Imidazole,2-((2,3-dihydro-1H-inden-1-ylidene)methyl)-1-methyl-5-nitro with cas registry number of 141363-21-5 is used as a pharmaceutical intermediates . It is also used as a reagent in biochemistry research . |
| Flash Point: | 245.9°C |
| Safety Data | |
 |
|
