Identification |
Name: | 7H-Indolo[1,7-bc][2,6]naphthyridine,4,5,7a,8,9,10,11,11a-octahydro-10-methyl-, (7aR,11aS)-rel- |
Synonyms: | 7H-Indolo[1,7-bc][2,6]naphthyridine,4,5,7a,8,9,10,11,11a-octahydro-10-methyl-, cis-; SDZ-SER 082 |
CAS: | 141474-54-6 |
Molecular Formula: | C15H20 N2 |
Molecular Weight: | 344.4 |
InChI: | InChI=1/C15H20N2.C4H4O4/c1-16-7-5-12-9-17-8-6-11-3-2-4-13(15(11)17)14(12)10-16;5-3(6)1-2-4(7)8/h2-4,12,14H,5-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t12-,14-;/m1./s1 |
Molecular Structure: |
![(C15H20N2) 7H-Indolo[1,7-bc][2,6]naphthyridine,4,5,7a,8,9,10,11,11a-octahydro-10-methyl-, cis-; SDZ-SER 082](https://img1.guidechem.com/chem/e/dict/23/141474-54-6.jpg) |
Properties |
Flash Point: | 293.2°C |
Boiling Point: | 561.2°Cat760mmHg |
Density: | g/cm3 |
Biological Activity: | Selective 5-HT 2B/2C receptor antagonist with low affinity for 5-HT 1A receptors. Inhibits [ 3 H]-mesulergine binding to 5-HT 2C receptors with a pK D of 7.8. Inhibits 5-HT 2B mediated responses in the rat fundus (pK B = 7.34). |
Flash Point: | 293.2°C |
Safety Data |
|
 |