| Identification |
| Name: | 2-Butenedioic acid(2Z)-, 1,4-bis(2-ethylhexyl) ester |
| Synonyms: | 2-Butenedioic acid (Z)-,bis(2-ethylhexyl) ester;Maleic acid, bis(2-ethylhexyl) ester (6CI,7CI,8CI);Bis(2-ethylhexyl) maleate;Ceraphyl 45;Di-2-ethylhexyl maleate;Dioctylmaleate;2-Butenedioicacid (2Z)-, bis(2-ethylhexyl) ester (9CI); |
| CAS: | 142-16-5 |
| EINECS: | 205-524-5 |
| Molecular Formula: | C20H36O4 |
| Molecular Weight: | 340.50 |
| InChI: | InChI=1/C20H36O4/c1-5-9-11-15(7-3)13-17(19(21)22)18(20(23)24)14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,21,22)(H,23,24)/p-2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Melting Point: | -40 C BOLING |
| Flash Point: | >110 ºC |
| Boiling Point: | 208-209°C 10mm |
| Density: | 0.944 |
| Stability: | No data. |
| Refractive index: | 1.455 |
| Solubility: | Insoluble SOLVENT Soluble in alcohols, acetone, ether, DMF, toluene; Insoluble: aliatic hydrocar |
| Appearance: | Clear to yellow liquid |
| Flash Point: | >110 ºC |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | LIQUID |
| Usage: | In copolymers, intermediate prc- in chemical reactions. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
