| Identification | |
| Name: | 2-Butenedioic acid(2E)-, ion(2-) |
| Synonyms: | 2-Butenedioicacid (E)-, ion(2-); Fumaric acid, ion(2-) (8CI); Fumarate; Fumarate dianion;Fumarate(2-); trans-2-Butenedioate dianion |
| CAS: | 142-42-7 |
| Molecular Formula: | C4H2 O4 |
| Molecular Weight: | 114.0574 |
| InChI: | InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.981°C |
| Boiling Point: | 355.482°C at 760 mmHg |
| Specification: |
Fumaric acid is an acid of Fumarate. It is a white crystalline compound. Fumaric acid, when added to food products, is an acidity regulator denoted by E number E297. Fumaric acid esters are sometimes used to treat psoriasis, as it has been suggested that the condition is caused by an impairment of fumaric acid production in the skin. It's side-effects include kidney or gastrointestinal disorders, as well as skin flushing; these are mainly caused by excess intake.Fumaric acid is also used in the manufacture of polyester resins and polyhydric alcohols and as a mordant for dyes. |
| Flash Point: | 182.981°C |
| Safety Data | |
 |
|
