| Identification | |
| Name: | Nabam |
| Synonyms: | Carbamicacid, ethylenebis[dithio-, disodium salt (8CI); Carbamodithioic acid,1,2-ethanediylbis-, disodium salt (9CI); Chem Bam; DSE; Disodiumethylenebis[dithiocarbamate]; Dithane A 40; Dithane D 14;Ethylenebis[dithiocarbamic acid] disodium salt; Nabam; Nafun IPO; Parzate;Parzate Liquid |
| CAS: | 142-59-6 |
| EINECS: | 205-547-0 |
| Molecular Formula: | C4H8 N2 S4 . 2 Na |
| Molecular Weight: | 256.34338 |
| InChI: | InChI=1S/C4H8N2S4.2Na/c7-3(8)5-1-2-6-4(9)10;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Melting Point: | 78-81 |
| Density: | g/cm3 |
| Solubility: | Insoluble in common organic solvents. Forms a continuous film on plant surfaces, which is said to become insoluble in water. In water, 2X10+5 mg/L at room temperature |
| Packinggroup: | O52 |
| Storage Temperature: | 0-6°C |
| Color: | Colorless crystals when pure. Crystals from water |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
