| Identification |
| Name: | Hexanoyl chloride |
| Synonyms: | Caproyl chloride; n-Hexanoyl chloride; n-Caproyl chloride; |
| CAS: | 142-61-0 |
| EINECS: | 205-549-1 |
| Molecular Formula: | C6H11ClO |
| Molecular Weight: | 134.6 |
| InChI: | InChI=1/C6H11ClO/c1-2-3-4-5-6(7)8/h2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Density: | 0.959 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4253-1.4273 |
| Water Solubility: | MAY DECOMPOSE |
| Solubility: | Decomposes |
| Appearance: | Clear to slightly yellow liquid |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
