| Identification | |
| Name: | Methyl 3-aminocrotonate |
| Synonyms: | methyl 3-amino-trans-but-2-enoate; 3-Aminocrotonic acid methyl ester |
| CAS: | 14205-39-1 |
| EINECS: | 238-056-5 |
| Molecular Formula: | C5H9NO2 |
| Molecular Weight: | 115.13 |
| InChI: | InChI=1/C5H9NO2/c1-4(6)3-5(7)8-2/h3H,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.031 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | yellowish semi-solid |
| HS Code: | 29224995 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Hygroscopic |
| Usage: | Methyl 3-aminocrotonate is used as intermediate for the syntheses of pharmaceuticals (e.g. 1,4-dihydropyridine derivatives) as well as for the manufacture of stabilizers and plastics. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
