| Identification |
| Name: | 2-Butenoic acid,3-amino-, 1,1'-(1,4-butanediyl) ester |
| Synonyms: | 2-Butenoicacid, 3-amino-, 1,4-butanediyl ester (9CI);Crotonic acid, 3-amino-,tetramethylene ester (7CI,8CI);1,4-Butanediol, bis(3-aminocrotonate) (8CI);1,4-Butanediol bis(b-aminocrotonate);Butanediol bis(b-aminocrotonate);Tetramethylene bis(b-aminocrotonate); |
| CAS: | 14205-47-1 |
| EINECS: | 238-059-1 |
| Molecular Formula: | C12H20N2O4 |
| Molecular Weight: | 256.3 |
| InChI: | InChI=1/C12H20N2O4/c1-9(13)7-11(15)17-5-3-4-6-18-12(16)8-10(2)14/h7-8H,3-6,13-14H2,1-2H3/b9-7-,10-8- |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 147-150 °C(lit.)
|
| Flash Point: | 191.2°C |
| Boiling Point: | 426.8°Cat760mmHg |
| Density: | 1.125g/cm3 |
| Refractive index: | 1.509 |
| Appearance: | white to yellow powder |
| Flash Point: | 191.2°C |
| Usage: | 1,4-Butyleneglycolbis(3-aminocrotonate) (BGAC) is used as stabilizer for PVC and vinylchloride copolymers for the food-packing industry. Product Data Sheet |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
