| Identification | |
| Name: | Bisoxireno[f,h]quinoline,1a,1b,2a,6b-tetrahydro-, (1aa,1bb,2ab,6ba)- (9CI) |
| Synonyms: | trans-Quinoline-5,6,7,8-dioxide |
| CAS: | 142129-81-5 |
| Molecular Formula: | C9H7 N O2 |
| Molecular Weight: | 161.17 |
| InChI: | InChI=1/C9H7NO2/c1-2-4-5(10-3-1)7-9(12-7)8-6(4)11-8/h1-3,6-9H/t6-,7?,8+,9?/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 123.8°C |
| Boiling Point: | 338.4°C at 760 mmHg |
| Density: | 1.477g/cm3 |
| Refractive index: | 1.663 |
| Specification: |
trans-Quinoline-5,6,7,8-dioxide , its cas register number is 142129-81-5. It also can be called (+-)-trans-5,6,7,8-Diepoxy-5,6,7,8-tetrahydroquinoline ; 1a,1b,2a,6b-Tetrahydrobisoxireno(f,h)quinoline (1a-alpha,1b-beta,2a-beta,6b-alpha)-(+-)- ; and Bisoxireno(f,h)quinoline, 1a,1b,2a,6b-tetrahydro-, (1a-alpha,1b-beta,2a-beta,6b-alpha)-(+-)- . |
| Flash Point: | 123.8°C |
| Safety Data | |
 |
|
