Identification |
Name: | Benzoic acid,2-[(methoxycarbonyl)oxy]- |
Synonyms: | Carbonicacid, methyl ester, ester with salicylic acid (7CI); NSC 89730 |
CAS: | 14216-34-3 |
Molecular Formula: | C9H8 O5 |
Molecular Weight: | 196.1568 |
InChI: | InChI=1/C9H8O5/c1-13-9(12)14-7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Flash Point: | 140.9°C |
Boiling Point: | 346.1°Cat760mmHg |
Density: | 1.343g/cm3 |
Refractive index: | 1.546 |
Flash Point: | 140.9°C |
Safety Data |
|
 |