| Identification | |
| Name: | Entecavir |
| Synonyms: | 2-amino-9-[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidene-cyclopentyl]-3H-purin-6-one;ETV;6H-Purin-6-one, 2-amino-1,9-dihydro-9-((1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-;2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidene-cyclopentyl]-3H-purin-6-one;SQ 34676;BMS 200475;Baraclude;6H-Purin-6-one,2-amino-1,9-dihydro-9- [(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2- methylenecyclopentyl]-;Taizhou hikong chemical sell Entecavir;Entecavi;Enteca;Entecavir(monohydrate)--Crude Product; |
| CAS: | 142217-69-4 |
| Molecular Formula: | C12H15N5O3 |
| Molecular Weight: | 277.28 |
| InChI: | InChI=1/C12H15N5O3/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20)/t6-,7+,8-/m0/s1 |
| Molecular Structure: | ![(C12H15N5O3) 2-amino-9-[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidene-cyclopentyl]-3H-purin-6-one;ETV;6H-Puri...](https://img.guidechem.com/casimg/142217-69-4.gif) |
| Properties | |
| Density: | 1.81g/cm3 |
| Refractive index: | 1.837 |
| Solubility: | In water, 2.4X10+3 mg/L, temp not specified |
| Appearance: | white to off-white/yellow crystalline powder |
| Color: | White to off white powder |
| Usage: | Entecavir (CAS NO.142217-69-4) is used to treat chronic hepatitis B. And it also helps prevent the hepatitis B virus from multiplying and infecting new liver cells. Besides, Entecavir is also indicated for the treatment of chronic hepatitis B in adults with HIV/AIDS infection, but Entecavir is not active against HIV. |
| Safety Data | |
 |
|
