Identification |
Name: | Phenol,3-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxy- |
Synonyms: | 5-Hydroxycarvedilol;5'-Hydroxyphenylcarvedilol; BM 140830 |
CAS: | 142227-51-8 |
Molecular Formula: | C24H26 N2 O5 |
Molecular Weight: | 422.47 |
InChI: | InChI=1/C24H26N2O5/c1-29-21-10-9-16(27)13-23(21)30-12-11-25-14-17(28)15-31-22-8-4-7-20-24(22)18-5-2-3-6-19(18)26-20/h2-10,13,17,25-28H,11-12,14-15H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 378.3°C |
Boiling Point: | 702°C at 760 mmHg |
Density: | 1.305g/cm3 |
Refractive index: | 1.674 |
Flash Point: | 378.3°C |
Usage: | A metabolite of Carvedilol which is a multiple-action, neurohormonal antagonist that is used in the treatment of hypertension |
Safety Data |
|
|