| Identification |
| Name: | Indolo[3,2-d][1]benzazepin-6(5H)-one,9-bromo-7,12-dihydro- |
| Synonyms: | 9-Bromopaullone;NSC 664704; |
| CAS: | 142273-20-9 |
| Molecular Formula: | C16H11BrN2O |
| Molecular Weight: | 327.17534 |
| InChI: | InChI=1S/C16H11BrN2O/c17-9-5-6-14-11(7-9)12-8-15(20)18-13-4-2-1-3-10(13)16(12)19-14/h1-7,19H,8H2,(H,18,20) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.596 g/cm3 |
| Refractive index: | 1.73 |
| Water Solubility: | DMSO: 18 mg/mL, clear, yellow |
| Solubility: | DMSO: 18 mg/mL, clear, yellow |
| Appearance: | tan solid |
| Biological Activity: | Potent inhibitor of CDK1/cyclin B and GSK-3 β (IC 50 values are 0.4 and 0.23 μ M respectively). Also inhibits CDK2/cyclin A, CDK2/cyclin E and CDK5/cyclin/p35 (IC 50 values are 0.68, 7.5 and 0.85 μ M respectively). Selective over c-src (IC 50 = 15 μ M), casein kinase 2 (IC 50 = 20 μ M), ERK1 (IC 50 = 20 μ M), ERK2 (IC 50 = 9 μ M) and a range of other protein kinases (IC 50 values > 35 μ M). Generates induced pluripotent stem cells (iPSCs) from somatic cells when used in combination with reprogramming factors; can replace Klf4. |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Usage: | The paullones are a novel class of kinase inhibitors, initially identified as CDK inhibitors. Kenpaullone has been found to be a useful GSK-3?inhibitor (IC50=23nM). |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
