Boronic acid,B-[3-(methoxymethyl)phenyl]- (142273-84-5)

The 3-Methoxymethylphenylboronic acid with its cas register number is 142273-84-5. It also can be called as 3-(Methoxymethyl)phenylboronic acid and the IUPAC Name about this chemical is [3-(methoxymethyl)phenyl]boronic acid. It belongs to the following product categories, such as blocks, BoronicAcids, Boronic acids, Aryl, Boronic acid, Organoborons and so on.

Physical properties about 3-Methoxymethylphenylboronic acid are: (1)#H bond acceptors: 3; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 27.69Ų; (5)Index of Refraction: 1.518; (6)Molar Refractivity: 44.28 cm³; (7)Molar Volume: 146 cm³; (8)Polarizability: 17.55x10^-24cm³; (9)Surface Tension: 41.3 dyne/cm; (10)Enthalpy of Vaporization: 58.19 kJ/mol; (11)Vapour Pressure: 0.00026 mmHg at 25°C

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: B(C1=CC(=CC=C1)COC)(O)O
(2)InChI: InChI=1S/C8H11BO3/c1-12-6-7-3-2-4-8(5-7)9(10)11/h2-5,10-11H,6H2,1H3
(3)InChIKey: XOSGESMDNPVZKS-UHFFFAOYSA-N