| Identification |
| Name: | 5-Thiazoleethanamine,2-amino-4-methyl- |
| Synonyms: | 5-(2-Aminoethyl)-4-methylthiazol-2-amine;Amthamine; |
| CAS: | 142437-67-0 |
| Molecular Formula: | C6H11N3S |
| Molecular Weight: | 157.23664 |
| InChI: | InChI=1S/C6H11N3S/c1-4-5(2-3-7)10-6(8)9-4/h2-3,7H2,1H3,(H2,8,9) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.236 g/cm3 |
| Water Solubility: | soluable in water |
| Solubility: | soluable in water |
| Appearance: | Cream crystalline solid |
| Biological Activity: | Highly selective H 2 agonist, slightly more potent than histamine itself. Only a weak antagonist at H 3 and has no activity at H 1 receptors. Induces vasodilation of cerebral arteries and decreases myogenic tone in vitro . |
| Safety Data |
| |
 |
