| Identification | |
| Name: | 3,4-(Methylenedioxy)aniline |
| Synonyms: | Aniline,3,4-(methylenedioxy)- (6CI,8CI);(Benzo[1,3]dioxol-5-yl)amine;(Benzodioxol-5-yl)amine;1,2-(Methylenedioxy)-4-aminobenzene;1,3-Benzodioxolan-6-amine;1-Amino-3,4-(methylenedioxy)benzene;3,4-(Methylenedioxy)-1-aminobenzene;1,3-Benzodioxol-5-amine;3,4-Methylendioxyaniline;3,4-Methylenedioxybenzeneamine;4-Amino-1,2-(methylenedioxy)benzene;5-Amino-1,3-benzodioxole;Benzo[d][1,3]dioxol-5-amine;Benzodioxol-5-amine;NSC155176; |
| CAS: | 14268-66-7 |
| EINECS: | 238-161-6 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4,8H2 |
| Molecular Structure: | ![(C7H7NO2) Aniline,3,4-(methylenedioxy)- (6CI,8CI);(Benzo[1,3]dioxol-5-yl)amine;(Benzodioxol-5-yl)amine;1,2-(Me...](https://img.guidechem.com/casimg/14268-66-7.gif) |
| Properties | |
| Density: | 1.332 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May discolor on exposure to air and light. |
| Refractive index: | 1.63 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | White to brown solid. |
| Packinggroup: | I; II; III |
| HS Code: | 29329970 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air & Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
