Identification |
Name: | 1H-Indole-3-acetamide,2-(4-fluorophenyl)-N,N-dihexyl- |
Synonyms: | FGIN 1-27 |
CAS: | 142720-24-9 |
Molecular Formula: | C28H37 F N2 O |
Molecular Weight: | 436.6 |
InChI: | InChI=1/C28H37FN2O/c1-3-5-7-11-19-31(20-12-8-6-4-2)27(32)21-25-24-13-9-10-14-26(24)30-28(25)22-15-17-23(29)18-16-22/h9-10,13-18,30H,3-8,11-12,19-21H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 321.7°C |
Boiling Point: | 608.3°Cat760mmHg |
Density: | 1.073g/cm3 |
Refractive index: | 1.562 |
Biological Activity: | Binds specifically and with high affinity to the peptide DBI receptor (benzodiazepine receptor) on mitochondrial membranes, inducing production of neurosteroids, which modulate GABA receptors (EC 50 = 3 nM for increase in production of pregnenolone in glial cells). Thus it reduces anxiety without causing sedation. |
Flash Point: | 321.7°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
 |