| Identification | |
| Name: | 9H-Thioxanthen-9-one,1-chloro-4-propoxy- |
| Synonyms: | 1-Chloro-4-propoxy-9H-thioxanthen-9-one;1-Chloro-4-propoxy-9H-thioxanthone;1-Chloro-4-propoxythioxanthone;KayacureCPTX;Quantacure CPTX;Speedcure CPTX; |
| CAS: | 142770-42-1 |
| Molecular Formula: | C16H13ClO2S |
| Molecular Weight: | 304.79 |
| InChI: | InChI=1/C16H13ClO2S/c1-2-9-19-12-8-7-11(17)14-15(18)10-5-3-4-6-13(10)20-16(12)14/h3-8H,2,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 100.0-103.0 |
| Boiling Point: | 467.4°C at 760 mmHg |
| Density: | 1.319g/cm3 |
| Refractive index: | 1.637 |
| Appearance: | bright yellow even solid powder |
| Specification: |
1-Chloro-4-propoxythioxanthone , its cas register number is 142770-42-1. It also can be called 1-Chloro-4-propoxy-9H-thioxanthen-9-one ; and 1-Chloro-4-propoxythioxanthone . Its classification code is TSCA Flag P [A commenced PMN (Premanufacture Notice) substance]. |
| Safety Data | |
 |
|
