| Identification |
| Name: | Benzenepropanenitrile,4-hydroxy-a-(4-hydroxyphenyl)- |
| Synonyms: | Propionitrile,2,3-bis(p-hydroxyphenyl)- (6CI,7CI,8CI); 2,3-Bis(4-hydroxyphenyl)propionitrile;2,3-Bis(p-hydroxyphenyl)propionitrile; DPN |
| CAS: | 1428-67-7 |
| Molecular Formula: | C15H13 N O2 |
| Molecular Weight: | 239.26922 |
| InChI: | InChI=1S/C15H13NO2/c16-10-13(12-3-7-15(18)8-4-12)9-11-1-5-14(17)6-2-11/h1-8,13,17-18H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.256 g/cm3 |
| Refractive index: | 1.639 |
| Water Solubility: | soluble to 100 mm inDMSO or to 100 mm in ethanol |
| Solubility: | soluble to 100 mm inDMSO or to 100 mm in ethanol |
| Appearance: | off-white solid |
| Biological Activity: | Highly potent estrogen ER β receptor agonist with a 70-fold selectivity over ER α (EC 50 values are 0.85 and 66 nM respectively). Relaxes mesenteric arteries in vitro . |
| Safety Data |
| |
 |
