Identification |
Name: | D-Alanine, methylester, hydrochloride (1:1) |
CAS: | 14316-06-4 |
EINECS: | 238-258-3 |
Molecular Formula: | C4H9NO2.HCl |
Molecular Weight: | 139.5807 |
InChI: | InChI=1S/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H |
Molecular Structure: |
 |
Properties |
Density: | 1.01g/cm3 |
Alpha: | -8 o (C=1.6, MEOH) |
Water Solubility: | Soluble in water (10%-clear, colorless) and methanol |
Solubility: | Soluble in water (10%-clear, colorless) and methanol |
Appearance: | White crystalline powder |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |