| Identification | |
| Name: | D-Alanine, methylester, hydrochloride (1:1) |
| CAS: | 14316-06-4 |
| EINECS: | 238-258-3 |
| Molecular Formula: | C4H9NO2.HCl |
| Molecular Weight: | 139.5807 |
| InChI: | InChI=1S/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.01g/cm3 |
| Alpha: | -8 o (C=1.6, MEOH) |
| Water Solubility: | Soluble in water (10%-clear, colorless) and methanol |
| Solubility: | Soluble in water (10%-clear, colorless) and methanol |
| Appearance: | White crystalline powder |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
