| Identification | |
| Name: | 2-Hexenoic acid, 5-oxo- |
| Synonyms: | (E)-5-oxohex-2-enoic acid;5-oxo-2-Hexenoic acid;5-Oxohex-2-enoic acid; |
| CAS: | 143228-86-8 |
| Molecular Formula: | C6H8O3 |
| Molecular Weight: | 128.12 |
| InChI: | InChI=1/C6H8O3/c1-5(7)3-2-4-6(8)9/h2,4H,3H2,1H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.135 g/cm3 |
| Refractive index: | 1.469 |
| Specification: |
The 5-Oxohex-2-enoic acid, with the cas registry number 143228-86-8, is also called 5-oxo-2-Hexenoic acid. It belongs to the product category of Acetyl group. And the molecular formula of the chemical is C6H8O3. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.00; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1.718; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 54.37 Å2; (11)Index of Refraction: 1.47; (12)Molar Refractivity: 31.498 cm3; (13)Molar Volume: 112.936 cm3; (14)Polarizability: 12.487×10-24cm3; (15)Surface Tension: 40.517 dyne/cm; (16)Density: 1.135 g/cm3; (17)Flash Point: 154.169 °C; (18)Enthalpy of Vaporization: 60.314 kJ/mol; (19)Boiling Point: 307.789 °C at 760 mmHg; (20)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
