| Identification | |
| Name: | 2-Chloro-1-methylpyridinium iodide |
| Synonyms: | N-Methyl-2-chloropyridinium iodide Mukaiyamas; CMPI |
| CAS: | 14338-32-0 |
| EINECS: | 238-288-7 |
| Molecular Formula: | C6H7ClIN |
| Molecular Weight: | 255.48 |
| InChI: | InChI=1/C6H7ClN.HI/c1-8-5-3-2-4-6(8)7;/h2-5H,1H3;1H/q+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.546 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | white crystalline powder |
| Specification: |
2-Chloro-1-methylpyridinium iodide , with CAS number of 14338-32-0, can be called pyridinium, 2-chloro-1-methyl-, iodide (1:1) ; pyridinium, 2-chloro-1-methyl-, iodide ; Mukaiyama's reagent ; N-Methyl-2-chloropyridinium iodide . It is a yellow crystalline solid. |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Flash Point: | °C |
| Sensitive: | Moisture & Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
