| Identification | |
| Name: | Emtricitabine |
| Synonyms: | 2(1H)-Pyrimidinone,4-amino-5-fluoro-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-, (2R-cis)-;(-)-2',3'-Dideoxy-5-fluoro-3'-thiacytidine;(-)-2'-Deoxy-5-fluoro-3'-thiacytidine;(-)-FTC;524W91;BW 1592;BW 524W91;Coviracil;Emtriva;FTC, (-)-; |
| CAS: | 143491-57-0 |
| Molecular Formula: | C8H10FN3O3S |
| Molecular Weight: | 247.25 |
| InChI: | InChI=1/C8H10FN3O3S/c9-4-1-12(8(14)11-7(4)10)5-3-16-6(2-13)15-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6+/m0/s1 |
| Molecular Structure: | ![(C8H10FN3O3S) 2(1H)-Pyrimidinone,4-amino-5-fluoro-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-, (2R-cis)-;(-)-2',3'-...](https://img.guidechem.com/casimg/143491-57-0.gif) |
| Properties | |
| Flash Point: | 221.9oC |
| Boiling Point: | 443.3oC at 760 mmHg |
| Density: | 1.82 g/cm3 |
| Refractive index: | 1.731 |
| Solubility: | About 112 mg/mL in water at 25 deg C |
| Appearance: | White powder |
| Specification: |
?Emtricitabine (CAS NO.143491-57-0) works by inhibiting reverse transcriptase which can help to lower the amount of HIV and increase the number of immune system cells. |
| Flash Point: | 221.9oC |
| Color: | White to off white powder White solid |
| Usage: | Emtricitabine (CAS NO.143491-57-0) is used as an anti-AIDS drug. It is also used as an antiviral drug. |
| Safety Data | |
 |
|
