| Identification |
| Name: | 3,4-Dichlorofluorobenzene |
| Synonyms: | 1,2-Dichloro-4-fluorobenzene; |
| CAS: | 1435-49-0 |
| EINECS: | 215-858-3 |
| Molecular Formula: | C6H3Cl2F |
| Molecular Weight: | 164.99 |
| InChI: | InChI=1/C6H3Cl2F/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1993 |
| Density: | 1.403 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.523-1.525 |
| Solubility: | Insoluble |
| Appearance: | clear colorless to slightly yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
