| Identification | |
| Name: | Mercury,phenyl(8-quinolinolato-kN1,kO8)- |
| Synonyms: | Mercury,(8-quinolinolato)phenyl- (7CI); Mercury, phenyl(8-quinolinolato-N1,O8)-;Quinoline, 8-(phenylmercurioxy)- (6CI); NSC 66326;Phenyl(8-quinolinolato)mercury; Phenylmercuric 8-hydroxyquinoline; Ventourini |
| CAS: | 14354-56-4 |
| EINECS: | 238-316-8 |
| Molecular Formula: | C15H11 Hg N O |
| Molecular Weight: | 421.86 |
| InChI: | InChI=1/C9H7NO.C6H5.Hg/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2-4-6-5-3-1;/h1-6,11H;1-5H;/rC9H7NO.C6H5Hg/c11-8-5-1-3-7-4-2-6-10-9(7)8;7-6-4-2-1-3-5-6/h1-6,11H;1-5H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.1°C |
| Boiling Point: | 267°Cat760mmHg |
| Density: | g/cm3 |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 143.1°C |
| Safety Data | |
 |
|
