| Identification | |
| Name: | cis-1,2-diaminocyclohexane |
| Synonyms: | Cyclohexanediamine; 96%; cis-1,2-Cyclohexanediamine |
| CAS: | 1436-59-5 |
| EINECS: | 205-754-6 |
| Molecular Formula: | C6H14N2 |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Melting Point: | 8°C |
| Flash Point: | 161? |
| Density: | 0.952 |
| Refractive index: | 1.493 |
| Appearance: | Clear colorless liquid |
| Specification: |
cis-1,2-Diaminocyclohexane (CAS No.1436-59-5), it also can be called 1,2-Cyclohexanediamine ; Cyclohexane-1,2-diamine ; 1,2-Diaminocyclohexane, mixture of cis and trans . |
| Packinggroup: | II |
| Flash Point: | 161? |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
