| Identification | |
| Name: | Bicyclo[2.2.1]heptane-2-methanamine |
| Synonyms: | 2-Norbornanemethylamine(6CI,7CI,8CI); 2-(Aminomethyl)bicyclo[2.2.1]heptane; 2-(Aminomethyl)norbornane;Bicyclo[2.2.1]heptane-2-methylamine; NSC 35381; Norbornylmethylamine;[(Bicyclo[2.2.1]heptan-2-yl)methyl]amine |
| CAS: | 14370-50-4 |
| Molecular Formula: | C8H15 N |
| Molecular Weight: | 125.24 |
| InChI: | InChI=1S/C8H15N/c9-5-8-4-6-1-2-7(8)3-6/h6-8H,1-5,9H2 |
| Molecular Structure: | ![(C8H15N) 2-Norbornanemethylamine(6CI,7CI,8CI); 2-(Aminomethyl)bicyclo[2.2.1]heptane; 2-(Aminomethyl)norbornan...](https://img1.guidechem.com/chem/e/dict/35/14370-50-4.jpg) |
| Properties | |
| Flash Point: | 48.7°C |
| Boiling Point: | 166°Cat760mmHg |
| Density: | 0.963g/cm3 |
| Specification: |
2 - (aminomethyl) norbornane (CAS NO.14370 - 50 - 4) is a toxic substance on the skin irritant, but also has a flammable, burning can produce toxic fumes of nitrogen oxides, it must be ventilated, low-temperature and dry environment in the storage and transportation, available dry powder, foam, sand, carbon dioxide, water mist fire extinguishers to be addressed. |
| Flash Point: | 48.7°C |
| Safety Data | |
 |
|
