| Identification |
| Name: | 4-Thiazolidinone,3-amino-2-thioxo- |
| Synonyms: | Rhodanine,3-amino- (6CI,7CI,8CI);3-Amino-2-thioxo-1,3-thiazolidin-4-one;3-Amino-2-thioxo-4-thiazolidinone;3-Aminorhodanine;N-Aminorhodanine;NSC23272; |
| CAS: | 1438-16-0 |
| EINECS: | 215-870-9 |
| Molecular Formula: | C3H4N2OS2 |
| Molecular Weight: | 148.2067 |
| InChI: | InChI=1/C3H4N2OS2/c4-5-2(6)1-8-3(5)7/h1,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.71 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.788 |
| Water Solubility: | insoluble in ethanol and ether |
| Solubility: | insoluble in ethanol and ether |
| Appearance: | yellowish crystalline powder |
| Packinggroup: | I; II; III |
| HS Code: | 29341000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T+: Very toxic
|
| |
 |
