| Identification | |
| Name: | 1H-Pyrrole,1-(2-furanylmethyl)- |
| Synonyms: | Pyrrole,1-furfuryl- (7CI,8CI); 1-(2-Furanylmethyl)-1H-pyrrole;1-(2-Furylmethyl)pyrrole; 1-Furfurylpyrrole; N-(2-Furfuryl)pyrrole;N-Furfurylpyrrole |
| CAS: | 1438-94-4 |
| EINECS: | 215-876-1 |
| Molecular Formula: | C9H9 N O |
| Molecular Weight: | 147.17 |
| InChI: | InChI=1/C9H9NO/c1-2-6-10(5-1)8-9-4-3-7-11-9/h1-7H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Density: | 1.081 |
| Refractive index: | 1.531 |
| Water Solubility: | Soluble in propylene glycol, acetone, chloroform, toluene etc. |
| Solubility: | Soluble in propylene glycol, acetone, chloroform, toluene etc. |
| Appearance: | Straw to dark brown clear liquid. |
| Specification: |
To protect yourself, you can put on eyeshields, Faceshields, full-face respirator (US), gloves, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
