| Identification | |
| Name: | 4-Pyrimidinamine,2-chloro-6-methyl- |
| Synonyms: | Pyrimidine,4-amino-2-chloro-6-methyl- (6CI,7CI,8CI); 2-Chloro-4-amino-6-methylpyrimidine;2-Chloro-6-methylpyrimidin-4-ylamine; 4-Amino-2-chloro-6-methylpyrimidine; NSC222758 |
| CAS: | 14394-60-6 |
| Molecular Formula: | C5H6 Cl N3 |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C5H6ClN3/c1-3-2-4(7)9-5(6)8-3/h2H,1H3,(H2,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143°C |
| Boiling Point: | 312.9°C at 760 mmHg |
| Density: | 1.349g/cm3 |
| Refractive index: | 1.599 |
| Specification: |
2-Chloro-6-methylpyrimidin-4-ylamine , with CAS number of 14394-60-6, can be called 4-pyrimidinamine, 2-chloro-6-methyl- ; 2-Chloro-6-methyl-4-pyrimidinamine ; 4-Amino-2-chloro-6-methylpyrimidine . |
| Flash Point: | 143°C |
| Safety Data | |
 |
|
