| Identification | |
| Name: | 2(1H)-Naphthalenone,5,7-dibromo-3,4-dihydro- |
| Synonyms: | 5,7-Dibromo-2-tetralone;5,7-Dibromo-3,4-dihydro-2(1H)-naphthalenone; |
| CAS: | 144066-44-4 |
| Molecular Formula: | C10H8Br2O |
| Molecular Weight: | 303.98 |
| InChI: | InChI=1/C10H8Br2O/c11-7-3-6-4-8(13)1-2-9(6)10(12)5-7/h3,5H,1-2,4H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.84 g/cm3 |
| Refractive index: | 1.627 |
| Specification: |
The CAS register number of 5,7-Dibromo-2-tetralone is 144066-44-4. It also can be called as 2(1H)-Naphthalenone,5,7-dibromo-3,4-dihydro- and the systematic name about this chemical is 5,7-dibromo-3,4-dihydronaphthalen-2(1H)-one. The molecular formula about this chemical is C10H8Br2O and the molecular weight is 303.98. Physical properties about 5,7-Dibromo-2-tetralone are: (1)ACD/LogP: 3.22; (2)ACD/LogD (pH 5.5): 3.22; (3)ACD/LogD (pH 7.4): 3.22; (4)ACD/BCF (pH 5.5): 165.73; (5)ACD/BCF (pH 7.4): 165.73; (6)ACD/KOC (pH 5.5): 1349.78; (7)ACD/KOC (pH 7.4): 1349.78; (8)#H bond acceptors: 1; (9)Polar Surface Area: 17.07Å2; (10)Index of Refraction: 1.627; (11)Molar Refractivity: 58.54 cm3; (12)Molar Volume: 165.1 cm3; (13)Polarizability: 23.21x10-24cm3; (14)Surface Tension: 50.3 dyne/cm; (15)Enthalpy of Vaporization: 61.71 kJ/mol; (16)Boiling Point: 370.2 °C at 760 mmHg; (17)Vapour Pressure: 1.13E-05 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
