| Identification | |
| Name: | Eprosartan mesylate |
| Synonyms: | Teveten (TN);(E)-2-Butyl-1-(p-carboxybenzyl)-alpha-2-thenylimidazole-5-acrylic acid, monomethanesulfonate;Eprosartan mesylate (USAN);2-Thiophenepropanoic acid,R-[[2-butyl-1-[(4-carboxyphenyl)- methyl]-1H-imidazol-5-yl]methylene]-,(RE)- ,monomethanesulfonate;Eprosartan mesylate [USAN:BAN];4-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-yl-prop-1-enyl]imidazol-1-yl]methyl]benzoic acid; methanesulfonic acid; |
| CAS: | 144143-96-4 |
| Molecular Formula: | C23H24N2O4S.CH4O3S |
| Molecular Weight: | 520.62 |
| InChI: | InChI=1/C23H24N2O4S.CH4O3S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27;1-5(2,3)4/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29);1H3,(H,2,3,4)/b18-12+; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 353.3 ºC |
| Boiling Point: | 660.6 ºC |
| Density: | 1.26 g/cm3 |
| Appearance: | A white to off- white powder |
| Specification: |
Eprosartan mesylate , with the cas number 347-54-6, its Synonyms are (E)-2-Butyl-1-(p-carboxybenzyl)-alpha-2-thenylimidazole-5-acrylic acid, monomethanesulfonate ; Epro-sartan mesylate dihydrate ; Teveten and so on and its IUPAC Name is 4-[[2-Butyl-5-[(E)-3-hydroxy-3-oxo-2-(thiophen-2-ylmethyl)prop-1-enyl] imidazol-1-yl]methyl]benzoic acid; methanesulfonic acid .It belongs to the following product categories, such as Eprosartan. Moreover, the molecular formula of Eprosartan mesylate is C23H24N2O4S.CH4O3S and its molecular weight is 520.62. In addition, Eprosartan mesylate is white to off- white powder. People can use the following data to convert to the molecule structure. Canonical SMILES: CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)C=C(CC3=CC=CS3)C(=O)O.CS(=O)(=O)O. Isomeric SMILES: CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)/C=C\CC3=CC=CS3)/C(=O)O.CS(=O)(=O)O. InChI: InChI=1S/C23H24N2O4S.CH4O3S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27;1-5(2,3)4/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29);1H3,(H,2,3,4)/b18-12+; InChIKey: DJSLTDBPKHORNY-XMMWENQYSA-N. |
| Flash Point: | 353.3 ºC |
| Safety Data | |
 |
|
