| Identification | |
| Name: | Benzenamine,4-(1H-1,2,4-triazol-1-ylmethyl)-, hydrochloride (1:1) |
| Synonyms: | Benzenamine,4-(1H-1,2,4-triazol-1-ylmethyl)-, monohydrochloride (9CI);4-(1,2,4-Triazol-1-ylmethyl)anilinehydrochloride;4-(1H-1,2,4-Triazol-1-ylmethyl)aniline hydrochloride;[4-[(1H-1,2,4-Triazol-1-yl)methyl]phenyl]amine hydrochloride; |
| CAS: | 144235-64-3 |
| Molecular Formula: | C9H10N4.HCl |
| Molecular Weight: | 210.66 |
| InChI: | InChI=1/C9H10N4.ClH/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13;/h1-4,6-7H,5,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197°C |
| Boiling Point: | 402.1°C at 760 mmHg |
| Density: | 1.401 g/cm3 |
| Appearance: | off-white to yellow powder |
| Specification: |
4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride , its cas register number is 144235-64-3. It also can be called benzenamine, 4-(1H-1,2,4-triazol-1-ylmethyl)-, hydrochloride (1:1) . 4-(1H-1,2,4-Triazol-1-ylmethyl)benzenamine hydrochloride (CAS NO.144235-64-3) is irritating to respiratory system and skin and it's risk of serious damage to the eyes. So you should wear suitable protective clothing, gloves and eye/face protection. |
| Flash Point: | 197°C |
| Safety Data | |
 |
|
